C21H32ClIN4O3Si — CID 174041995
7-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2-chloro-5-iodopyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 174041995) has the molecular formula C21H32ClIN4O3Si and a molecular weight of 578.96 g/mol. Its IUPAC name is 7-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2-chloro-5-iodopyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2-chloro-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 174041995 |
| Molecular Formula | C21H32ClIN4O3Si |
| Molecular Weight | 578.96 g/mol |
| Exact Mass | 578.10 |
| IUPAC Name | 7-[(3aS,4R,6R,6aR)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl]-2-chloro-5-iodopyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](n3cc(I)c4c(N)nc(Cl)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C21H32ClIN4O3Si/c1-20(2,3)31(6,7)28-10-11-8-13(16-15(11)29-21(4,5)30-16)27-9-12(23)14-17(24)25-19(22)26-18(14)27/h9,11,13,15-16H,8,10H2,1-7H3,(H2,24,25,26)/t11-,13-,15-,16+/m1/s1 |
| InChIKey | WVOHTVLRNFNKAA-CUBALJKWSA-N |
| XLogP | 5.37 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|