C25H34ClN3O3SSi — CID 174041996
[(3aS,4R,6R,6aR)-4-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 174041996) has the molecular formula C25H34ClN3O3SSi and a molecular weight of 520.17 g/mol. Its IUPAC name is [(3aS,4R,6R,6aR)-4-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4R,6R,6aR)-4-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 174041996 |
| Molecular Formula | C25H34ClN3O3SSi |
| Molecular Weight | 520.17 g/mol |
| Exact Mass | 519.18 |
| IUPAC Name | [(3aS,4R,6R,6aR)-4-(2-chloro-5-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)C[C@@H](n3cc(-c4cccs4)c4cnc(Cl)nc43)[C@@H]2O1 |
| InChI | InChI=1S/C25H34ClN3O3SSi/c1-24(2,3)34(6,7)30-14-15-11-18(21-20(15)31-25(4,5)32-21)29-13-17(19-9-8-10-33-19)16-12-27-23(26)28-22(16)29/h8-10,12-13,15,18,20-21H,11,14H2,1-7H3/t15-,18-,20-,21+/m1/s1 |
| InChIKey | YXVYIEAFLFZKPV-SKBHOOIQSA-N |
| XLogP | 6.92 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.17 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|