About methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate
methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate (PubChem CID 174042099) has the molecular formula C15H28O6Si
and a molecular weight of 332.47 g/mol. Its IUPAC name is methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate |
| PubChem CID | 174042099 |
| Molecular Formula | C15H28O6Si |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CC(=O)C(O[Si](C)(C)C(C)(C)C)[C@@H](CO)O1 |
| InChI | InChI=1S/C15H28O6Si/c1-15(2,3)22(5,6)21-14-11(17)7-10(8-13(18)19-4)20-12(14)9-16/h10,12,14,16H,7-9H2,1-6H3/t10-,12+,14?/m0/s1 |
| InChIKey | XDBNKYIVSHWFBC-QXQDIAAESA-N |
| XLogP | 1.66 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate?
The IUPAC name of methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate (CID 174042099) is methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate?
The canonical SMILES for methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate is COC(=O)C[C@@H]1CC(=O)C(O[Si](C)(C)C(C)(C)C)[C@@H](CO)O1.
What is the InChIKey of methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate?
The InChIKey is XDBNKYIVSHWFBC-QXQDIAAESA-N. The full InChI is InChI=1S/C15H28O6Si/c1-15(2,3)22(5,6)21-14-11(17)7-10(8-13(18)19-4)20-12(14)9-16/h10,12,14,16H,7-9H2,1-6H3/t10-,12+,14?/m0/s1.
What are the key properties of methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate?
methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate has a molecular weight of 332.47 g/mol, XLogP of 1.66, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-oxooxan-2-yl]acetate is sourced from PubChem (CID 174042099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).