About N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide
N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide (PubChem CID 174042522) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide.
Molecular Properties
| Compound Name | N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide |
| PubChem CID | 174042522 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide |
| SMILES | C=N/C(C=C(NCC(C)C)C(=C)C)=N\CCCC |
| InChI | InChI=1S/C15H27N3/c1-7-8-9-17-15(16-6)10-14(13(4)5)18-11-12(2)3/h10,12,18H,4,6-9,11H2,1-3,5H3/b14-10?,17-15- |
| InChIKey | BVCGBHLVAZHVKW-IOMNLXDKSA-N |
| XLogP | 3.59 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide?
The IUPAC name of N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide (CID 174042522) is N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide.
What is the SMILES notation for N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide?
The canonical SMILES for N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide is C=N/C(C=C(NCC(C)C)C(=C)C)=N\CCCC.
What is the InChIKey of N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide?
The InChIKey is BVCGBHLVAZHVKW-IOMNLXDKSA-N. The full InChI is InChI=1S/C15H27N3/c1-7-8-9-17-15(16-6)10-14(13(4)5)18-11-12(2)3/h10,12,18H,4,6-9,11H2,1-3,5H3/b14-10?,17-15-.
What are the key properties of N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide?
N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide has a molecular weight of 249.40 g/mol, XLogP of 3.59, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-4-methyl-N-methylidene-3-(2-methylpropylamino)penta-2,4-dienimidamide is sourced from PubChem (CID 174042522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).