About 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide
4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide (PubChem CID 174042525) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide.
Molecular Properties
| Compound Name | 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide |
| PubChem CID | 174042525 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide |
| SMILES | C=CC/N=C(/C=C(NCC(C)C)C(=C)C)N=C |
| InChI | InChI=1S/C14H23N3/c1-7-8-16-14(15-6)9-13(12(4)5)17-10-11(2)3/h7,9,11,17H,1,4,6,8,10H2,2-3,5H3/b13-9?,16-14- |
| InChIKey | MZKBIPDESYKHHM-PISATYGPSA-N |
| XLogP | 2.98 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide?
The IUPAC name of 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide (CID 174042525) is 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide.
What is the SMILES notation for 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide?
The canonical SMILES for 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide is C=CC/N=C(/C=C(NCC(C)C)C(=C)C)N=C.
What is the InChIKey of 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide?
The InChIKey is MZKBIPDESYKHHM-PISATYGPSA-N. The full InChI is InChI=1S/C14H23N3/c1-7-8-16-14(15-6)9-13(12(4)5)17-10-11(2)3/h7,9,11,17H,1,4,6,8,10H2,2-3,5H3/b13-9?,16-14-.
What are the key properties of 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide?
4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide has a molecular weight of 233.36 g/mol, XLogP of 2.98, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-methylidene-3-(2-methylpropylamino)-N'-prop-2-enylpenta-2,4-dienimidamide is sourced from PubChem (CID 174042525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).