C19H32BNO — CID 174043748
1-but-1-en-2-yl-2-(2,9,9-trimethyl-5-oxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine (PubChem CID 174043748) has the molecular formula C19H32BNO and a molecular weight of 301.28 g/mol. Its IUPAC name is 1-but-1-en-2-yl-2-(2,9,9-trimethyl-5-oxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine.
| Compound Name | 1-but-1-en-2-yl-2-(2,9,9-trimethyl-5-oxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine |
|---|---|
| PubChem CID | 174043748 |
| Molecular Formula | C19H32BNO |
| Molecular Weight | 301.28 g/mol |
| Exact Mass | 301.26 |
| IUPAC Name | 1-but-1-en-2-yl-2-(2,9,9-trimethyl-5-oxa-4-boratricyclo[6.1.1.02,6]decan-4-yl)pyrrolidine |
| SMILES | C=C(CC)N1CCCC1B1CC2(C)C(CC3CC2C3(C)C)O1 |
| InChI | InChI=1S/C19H32BNO/c1-6-13(2)21-9-7-8-17(21)20-12-19(5)15-10-14(18(15,3)4)11-16(19)22-20/h14-17H,2,6-12H2,1,3-5H3 |
| InChIKey | LTKHOMSSRQNWIF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|