C18H31FO8Si — CID 174043883
[(2R,3R,4S,5R)-5,6-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorooxan-3-yl] acetate (PubChem CID 174043883) has the molecular formula C18H31FO8Si and a molecular weight of 422.52 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5,6-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorooxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R)-5,6-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorooxan-3-yl] acetate |
|---|---|
| PubChem CID | 174043883 |
| Molecular Formula | C18H31FO8Si |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [(2R,3R,4S,5R)-5,6-diacetyloxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-fluorooxan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC(C)=O)[C@H](F)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H31FO8Si/c1-10(20)24-15-13(9-23-28(7,8)18(4,5)6)27-17(26-12(3)22)16(14(15)19)25-11(2)21/h13-17H,9H2,1-8H3/t13-,14+,15-,16+,17?/m1/s1 |
| InChIKey | IUJLERGKDIUIBE-VPEURPPWSA-N |
| XLogP | 2.50 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|