C20H34N2 — CID 174043984
N'-methyl-N-[[(5Z)-2,5,8,10-tetramethyl-9-propan-2-ylcyclodeca-1,5,9-trien-1-yl]methyl]methanimidamide (PubChem CID 174043984) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is N'-methyl-N-[[(5Z)-2,5,8,10-tetramethyl-9-propan-2-ylcyclodeca-1,5,9-trien-1-yl]methyl]methanimidamide.
| Compound Name | N'-methyl-N-[[(5Z)-2,5,8,10-tetramethyl-9-propan-2-ylcyclodeca-1,5,9-trien-1-yl]methyl]methanimidamide |
|---|---|
| PubChem CID | 174043984 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | N'-methyl-N-[[(5Z)-2,5,8,10-tetramethyl-9-propan-2-ylcyclodeca-1,5,9-trien-1-yl]methyl]methanimidamide |
| SMILES | C/N=C/NCC1=C(C)CC/C(C)=C\CC(C)C(C(C)C)=C1C |
| InChI | InChI=1S/C20H34N2/c1-14(2)20-17(5)11-9-15(3)8-10-16(4)19(18(20)6)12-22-13-21-7/h9,13-14,17H,8,10-12H2,1-7H3,(H,21,22)/b15-9-,19-16?,20-18? |
| InChIKey | CYPZJZRTFBKPLF-IIZLUCCCSA-N |
| XLogP | 5.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|