C20H25NO2 — CID 174044276
(3R,6aR)-6,8-dimethoxy-2,3,11-trimethyl-1,3,6a,7-tetrahydroindeno[1,2-d]isoindole (PubChem CID 174044276) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (3R,6aR)-6,8-dimethoxy-2,3,11-trimethyl-1,3,6a,7-tetrahydroindeno[1,2-d]isoindole.
| Compound Name | (3R,6aR)-6,8-dimethoxy-2,3,11-trimethyl-1,3,6a,7-tetrahydroindeno[1,2-d]isoindole |
|---|---|
| PubChem CID | 174044276 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (3R,6aR)-6,8-dimethoxy-2,3,11-trimethyl-1,3,6a,7-tetrahydroindeno[1,2-d]isoindole |
| SMILES | COC1=CC=C2[C@@H](C)N(C)CC23c2c(C)ccc(OC)c2C[C@@H]13 |
| InChI | InChI=1S/C20H25NO2/c1-12-6-8-17(22-4)14-10-16-18(23-5)9-7-15-13(2)21(3)11-20(15,16)19(12)14/h6-9,13,16H,10-11H2,1-5H3/t13-,16+,20?/m1/s1 |
| InChIKey | RXDDNLYQFSFOES-YDCKXFNSSA-N |
| XLogP | 3.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |