About N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide
N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide (PubChem CID 174044309) has the molecular formula C9H21NO3S
and a molecular weight of 223.34 g/mol. Its IUPAC name is N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide |
| PubChem CID | 174044309 |
| Molecular Formula | C9H21NO3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide |
| SMILES | CC(C)C[C@@H]([C@H](C)O)N(C)S(C)(=O)=O |
| InChI | InChI=1S/C9H21NO3S/c1-7(2)6-9(8(3)11)10(4)14(5,12)13/h7-9,11H,6H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | VGZRCEFHWFKTOA-IUCAKERBSA-N |
| XLogP | 0.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide?
The IUPAC name of N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide (CID 174044309) is N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide.
What is the SMILES notation for N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide?
The canonical SMILES for N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide is CC(C)C[C@@H]([C@H](C)O)N(C)S(C)(=O)=O.
What is the InChIKey of N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide?
The InChIKey is VGZRCEFHWFKTOA-IUCAKERBSA-N. The full InChI is InChI=1S/C9H21NO3S/c1-7(2)6-9(8(3)11)10(4)14(5,12)13/h7-9,11H,6H2,1-5H3/t8-,9-/m0/s1.
What are the key properties of N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide?
N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide has a molecular weight of 223.34 g/mol, XLogP of 0.67, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3S)-2-hydroxy-5-methylhexan-3-yl]-N-methylmethanesulfonamide is sourced from PubChem (CID 174044309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).