C31H33FN6O4 — CID 174045240
2-[[4-[N-[(1E)-1-[(4-cyano-2-fluorophenyl)methoxy]buta-1,3-dienyl]-C-methylcarbonimidoyl]piperazin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid (PubChem CID 174045240) has the molecular formula C31H33FN6O4 and a molecular weight of 572.64 g/mol. Its IUPAC name is 2-[[4-[N-[(1E)-1-[(4-cyano-2-fluorophenyl)methoxy]buta-1,3-dienyl]-C-methylcarbonimidoyl]piperazin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid.
| Compound Name | 2-[[4-[N-[(1E)-1-[(4-cyano-2-fluorophenyl)methoxy]buta-1,3-dienyl]-C-methylcarbonimidoyl]piperazin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 174045240 |
| Molecular Formula | C31H33FN6O4 |
| Molecular Weight | 572.64 g/mol |
| Exact Mass | 572.25 |
| IUPAC Name | 2-[[4-[N-[(1E)-1-[(4-cyano-2-fluorophenyl)methoxy]buta-1,3-dienyl]-C-methylcarbonimidoyl]piperazin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid |
| SMILES | C=C/C=C(\N=C(C)N1CCN(Cc2nc3ccc(C(=O)O)cc3n2C[C@@H]2CCO2)CC1)OCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C31H33FN6O4/c1-3-4-30(42-20-24-6-5-22(17-33)15-26(24)32)34-21(2)37-12-10-36(11-13-37)19-29-35-27-8-7-23(31(39)40)16-28(27)38(29)18-25-9-14-41-25/h3-8,15-16,25H,1,9-14,18-20H2,2H3,(H,39,40)/b30-4+,34-21?/t25-/m0/s1 |
| InChIKey | MEJAKCLQBVHXSA-JQDMMMAXSA-N |
| XLogP | 4.31 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.64 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|