C19H30S — CID 174045718
(7R)-10-ethenyl-11-ethyl-11-methyltetracyclo[10.2.0.02,5.03,14]tetradecane-7-thiol (PubChem CID 174045718) has the molecular formula C19H30S and a molecular weight of 290.52 g/mol. Its IUPAC name is (7R)-10-ethenyl-11-ethyl-11-methyltetracyclo[10.2.0.02,5.03,14]tetradecane-7-thiol.
| Compound Name | (7R)-10-ethenyl-11-ethyl-11-methyltetracyclo[10.2.0.02,5.03,14]tetradecane-7-thiol |
|---|---|
| PubChem CID | 174045718 |
| Molecular Formula | C19H30S |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (7R)-10-ethenyl-11-ethyl-11-methyltetracyclo[10.2.0.02,5.03,14]tetradecane-7-thiol |
| SMILES | C=CC1CC[C@@H](S)CC2CC3C4CC(C4C23)C1(C)CC |
| InChI | InChI=1S/C19H30S/c1-4-12-6-7-13(20)8-11-9-14-15-10-16(18(15)17(11)14)19(12,3)5-2/h4,11-18,20H,1,5-10H2,2-3H3/t11?,12?,13-,14?,15?,16?,17?,18?,19?/m1/s1 |
| InChIKey | AAIQCXFDASLYRM-DXZGVAIMSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|