C46H41NSi — CID 174046078
9,9-dimethyl-N-(2-phenylphenyl)-N-[3-(8-trimethylsilylnaphthalen-1-yl)phenyl]fluoren-3-amine (PubChem CID 174046078) has the molecular formula C46H41NSi and a molecular weight of 635.93 g/mol. Its IUPAC name is 9,9-dimethyl-N-(2-phenylphenyl)-N-[3-(8-trimethylsilylnaphthalen-1-yl)phenyl]fluoren-3-amine.
| Compound Name | 9,9-dimethyl-N-(2-phenylphenyl)-N-[3-(8-trimethylsilylnaphthalen-1-yl)phenyl]fluoren-3-amine |
|---|---|
| PubChem CID | 174046078 |
| Molecular Formula | C46H41NSi |
| Molecular Weight | 635.93 g/mol |
| Exact Mass | 635.30 |
| IUPAC Name | 9,9-dimethyl-N-(2-phenylphenyl)-N-[3-(8-trimethylsilylnaphthalen-1-yl)phenyl]fluoren-3-amine |
| SMILES | CC1(C)c2ccccc2-c2cc(N(c3cccc(-c4cccc5cccc([Si](C)(C)C)c45)c3)c3ccccc3-c3ccccc3)ccc21 |
| InChI | InChI=1S/C46H41NSi/c1-46(2)41-25-11-9-23-39(41)40-31-36(28-29-42(40)46)47(43-26-12-10-22-37(43)32-16-7-6-8-17-32)35-21-13-20-34(30-35)38-24-14-18-33-19-15-27-44(45(33)38)48(3,4)5/h6-31H,1-5H3 |
| InChIKey | MUCWDMOUZUCHEV-UHFFFAOYSA-N |
| XLogP | 12.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.93 |
| LogP ≤ 5 | 12.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|