C49H92N2 — CID 174046095
1-[(5E,11Z)-13-ethyl-5-(2-ethyldecyl)-11-undecan-3-ylhenicosa-5,11-dienyl]imidazole (PubChem CID 174046095) has the molecular formula C49H92N2 and a molecular weight of 709.29 g/mol. Its IUPAC name is 1-[(5E,11Z)-13-ethyl-5-(2-ethyldecyl)-11-undecan-3-ylhenicosa-5,11-dienyl]imidazole.
| Compound Name | 1-[(5E,11Z)-13-ethyl-5-(2-ethyldecyl)-11-undecan-3-ylhenicosa-5,11-dienyl]imidazole |
|---|---|
| PubChem CID | 174046095 |
| Molecular Formula | C49H92N2 |
| Molecular Weight | 709.29 g/mol |
| Exact Mass | 708.73 |
| IUPAC Name | 1-[(5E,11Z)-13-ethyl-5-(2-ethyldecyl)-11-undecan-3-ylhenicosa-5,11-dienyl]imidazole |
| SMILES | CCCCCCCCC(/C=C(/CCCC/C=C(\CCCCn1ccnc1)CC(CC)CCCCCCCC)C(CC)CCCCCCCC)CC |
| InChI | InChI=1S/C49H92N2/c1-7-13-16-19-22-26-33-45(10-4)42-47(36-31-32-40-51-41-39-50-44-51)35-28-25-30-38-49(48(12-6)37-29-24-21-18-15-9-3)43-46(11-5)34-27-23-20-17-14-8-2/h35,39,41,43-46,48H,7-34,36-38,40,42H2,1-6H3/b47-35+,49-43- |
| InChIKey | SDFLZEKOFNKNGO-OEUHMHJQSA-N |
| XLogP | 17.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.29 |
| LogP ≤ 5 | 17.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|