C46H50BN — CID 174046175
18-tert-butyl-8-(4-tert-butylphenyl)-4,14,14-trimethyl-11-(5,6,7,8-tetrahydronaphthalen-1-yl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 174046175) has the molecular formula C46H50BN and a molecular weight of 627.73 g/mol. Its IUPAC name is 18-tert-butyl-8-(4-tert-butylphenyl)-4,14,14-trimethyl-11-(5,6,7,8-tetrahydronaphthalen-1-yl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 18-tert-butyl-8-(4-tert-butylphenyl)-4,14,14-trimethyl-11-(5,6,7,8-tetrahydronaphthalen-1-yl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 174046175 |
| Molecular Formula | C46H50BN |
| Molecular Weight | 627.73 g/mol |
| Exact Mass | 627.40 |
| IUPAC Name | 18-tert-butyl-8-(4-tert-butylphenyl)-4,14,14-trimethyl-11-(5,6,7,8-tetrahydronaphthalen-1-yl)-8-aza-1-borapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | Cc1ccc2c(c1)B1c3cc(C(C)(C)C)ccc3C(C)(C)c3cc(-c4cccc5c4CCCC5)cc(c31)N2c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C46H50BN/c1-29-17-24-41-40(25-29)47-39-28-33(45(5,6)7)20-23-37(39)46(8,9)38-26-31(36-16-12-14-30-13-10-11-15-35(30)36)27-42(43(38)47)48(41)34-21-18-32(19-22-34)44(2,3)4/h12,14,16-28H,10-11,13,15H2,1-9H3 |
| InChIKey | GMMCWMKFOZZEBL-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.73 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|