C19H31ClN6O3 — CID 174046534
(2S)-2-[(4-amino-3-chloro-2-methyliminopent-3-enyl)-hydroxyamino]-N-[1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-4-methylpentanamide (PubChem CID 174046534) has the molecular formula C19H31ClN6O3 and a molecular weight of 426.95 g/mol. Its IUPAC name is (2S)-2-[(4-amino-3-chloro-2-methyliminopent-3-enyl)-hydroxyamino]-N-[1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-4-methylpentanamide.
| Compound Name | (2S)-2-[(4-amino-3-chloro-2-methyliminopent-3-enyl)-hydroxyamino]-N-[1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 174046534 |
| Molecular Formula | C19H31ClN6O3 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (2S)-2-[(4-amino-3-chloro-2-methyliminopent-3-enyl)-hydroxyamino]-N-[1-cyano-2-(2-oxopyrrolidin-3-yl)ethyl]-4-methylpentanamide |
| SMILES | C/N=C(/CN(O)[C@@H](CC(C)C)C(=O)NC(C#N)CC1CCNC1=O)C(Cl)=C(C)N |
| InChI | InChI=1S/C19H31ClN6O3/c1-11(2)7-16(26(29)10-15(23-4)17(20)12(3)22)19(28)25-14(9-21)8-13-5-6-24-18(13)27/h11,13-14,16,29H,5-8,10,22H2,1-4H3,(H,24,27)(H,25,28)/b17-12?,23-15-/t13?,14?,16-/m0/s1 |
| InChIKey | VADGGSNSFKGQOK-ZWPSOKDASA-N |
| XLogP | 1.13 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|