C28H26B2F5N3O6S — CID 174046580
CID 174046580 (PubChem CID 174046580) has the molecular formula C28H26B2F5N3O6S and a molecular weight of 649.21 g/mol.
| Compound Name | CID 174046580 |
|---|---|
| PubChem CID | 174046580 |
| Molecular Formula | C28H26B2F5N3O6S |
| Molecular Weight | 649.21 g/mol |
| Exact Mass | 649.16 |
| IUPAC Name | — |
| SMILES | [B]C([B])(NC(=O)c1ccc(N2C[C@@H](Oc3ccc(OC(F)(F)F)cn3)C[C@H]2COC(F)F)cc1)c1ccc(S(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C28H26B2F5N3O6S/c1-2-45(40,41)23-10-5-18(6-11-23)27(29,30)37-25(39)17-3-7-19(8-4-17)38-15-22(13-20(38)16-42-26(31)32)43-24-12-9-21(14-36-24)44-28(33,34)35/h3-12,14,20,22,26H,2,13,15-16H2,1H3,(H,37,39)/t20-,22-/m0/s1 |
| InChIKey | IFUHLEGPQCJMIP-UNMCSNQZSA-N |
| XLogP | 3.92 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|