About N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine
N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine (PubChem CID 174046640) has the molecular formula C11H19BN2
and a molecular weight of 190.10 g/mol. Its IUPAC name is N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine.
Molecular Properties
| Compound Name | N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine |
| PubChem CID | 174046640 |
| Molecular Formula | C11H19BN2 |
| Molecular Weight | 190.10 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine |
| SMILES | CNB(NC)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C11H19BN2/c1-8-6-9(2)11(10(3)7-8)12(13-4)14-5/h6-7,13-14H,1-5H3 |
| InChIKey | XEQQIIONKWKTJT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.10 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine?
The IUPAC name of N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine (CID 174046640) is N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine.
What is the SMILES notation for N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine?
The canonical SMILES for N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine is CNB(NC)c1c(C)cc(C)cc1C.
What is the InChIKey of N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine?
The InChIKey is XEQQIIONKWKTJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BN2/c1-8-6-9(2)11(10(3)7-8)12(13-4)14-5/h6-7,13-14H,1-5H3.
What are the key properties of N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine?
N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine has a molecular weight of 190.10 g/mol, XLogP of 0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[methylamino-(2,4,6-trimethylphenyl)boranyl]methanamine is sourced from PubChem (CID 174046640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).