C12H17BN2 — CID 174046647
1,3,6-trimethyl-2-phenyl-4H-1,3,2-diazaborinine (PubChem CID 174046647) has the molecular formula C12H17BN2 and a molecular weight of 200.09 g/mol. Its IUPAC name is 1,3,6-trimethyl-2-phenyl-4H-1,3,2-diazaborinine.
| Compound Name | 1,3,6-trimethyl-2-phenyl-4H-1,3,2-diazaborinine |
|---|---|
| PubChem CID | 174046647 |
| Molecular Formula | C12H17BN2 |
| Molecular Weight | 200.09 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1,3,6-trimethyl-2-phenyl-4H-1,3,2-diazaborinine |
| SMILES | CC1=CCN(C)B(c2ccccc2)N1C |
| InChI | InChI=1S/C12H17BN2/c1-11-9-10-14(2)13(15(11)3)12-7-5-4-6-8-12/h4-9H,10H2,1-3H3 |
| InChIKey | QWSKHSVUBBDQTI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.09 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|