C19H18N4 — CID 174047004
1-(6-cyclopropylpyrimidin-4-yl)-6-[(2R)-spiro[2.2]pentan-2-yl]indazole (PubChem CID 174047004) has the molecular formula C19H18N4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-(6-cyclopropylpyrimidin-4-yl)-6-[(2R)-spiro[2.2]pentan-2-yl]indazole.
| Compound Name | 1-(6-cyclopropylpyrimidin-4-yl)-6-[(2R)-spiro[2.2]pentan-2-yl]indazole |
|---|---|
| PubChem CID | 174047004 |
| Molecular Formula | C19H18N4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-(6-cyclopropylpyrimidin-4-yl)-6-[(2R)-spiro[2.2]pentan-2-yl]indazole |
| SMILES | c1nc(C2CC2)cc(-n2ncc3ccc([C@@H]4CC45CC5)cc32)n1 |
| InChI | InChI=1S/C19H18N4/c1-2-12(1)16-8-18(21-11-20-16)23-17-7-13(3-4-14(17)10-22-23)15-9-19(15)5-6-19/h3-4,7-8,10-12,15H,1-2,5-6,9H2/t15-/m0/s1 |
| InChIKey | GJXBXUYFMGKRDL-HNNXBMFYSA-N |
| XLogP | 3.96 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |