About 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine
4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine (PubChem CID 174047146) has the molecular formula C14H23F3N2
and a molecular weight of 276.35 g/mol. Its IUPAC name is 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine.
Molecular Properties
| Compound Name | 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine |
| PubChem CID | 174047146 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine |
| SMILES | C=C(CC)C1CCNCC1N/C(=C\CC)C(F)(F)F |
| InChI | InChI=1S/C14H23F3N2/c1-4-6-13(14(15,16)17)19-12-9-18-8-7-11(12)10(3)5-2/h6,11-12,18-19H,3-5,7-9H2,1-2H3/b13-6- |
| InChIKey | JPBCAKCVKUUHRN-MLPAPPSSSA-N |
| XLogP | 3.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine?
The IUPAC name of 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine (CID 174047146) is 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine.
What is the SMILES notation for 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine?
The canonical SMILES for 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine is C=C(CC)C1CCNCC1N/C(=C\CC)C(F)(F)F.
What is the InChIKey of 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine?
The InChIKey is JPBCAKCVKUUHRN-MLPAPPSSSA-N. The full InChI is InChI=1S/C14H23F3N2/c1-4-6-13(14(15,16)17)19-12-9-18-8-7-11(12)10(3)5-2/h6,11-12,18-19H,3-5,7-9H2,1-2H3/b13-6-.
What are the key properties of 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine?
4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine has a molecular weight of 276.35 g/mol, XLogP of 3.38, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-1-en-2-yl-N-[(Z)-1,1,1-trifluoropent-2-en-2-yl]piperidin-3-amine is sourced from PubChem (CID 174047146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).