C18H15BrF2N2O3 — CID 17404717
3-[(4-bromophenyl)methyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 17404717) has the molecular formula C18H15BrF2N2O3 and a molecular weight of 425.23 g/mol. Its IUPAC name is 3-[(4-bromophenyl)methyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(4-bromophenyl)methyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17404717 |
| Molecular Formula | C18H15BrF2N2O3 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 3-[(4-bromophenyl)methyl]-5-[4-(difluoromethoxy)phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(Cc2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C18H15BrF2N2O3/c1-18(12-4-8-14(9-5-12)26-16(20)21)15(24)23(17(25)22-18)10-11-2-6-13(19)7-3-11/h2-9,16H,10H2,1H3,(H,22,25) |
| InChIKey | PFURYHADANUXOT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|