C17H24N2 — CID 174047615
(4aZ,6Z,8Z)-N,2-di(propan-2-yl)-3,4-dihydrocycloocta[c]pyridin-1-imine (PubChem CID 174047615) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (4aZ,6Z,8Z)-N,2-di(propan-2-yl)-3,4-dihydrocycloocta[c]pyridin-1-imine.
| Compound Name | (4aZ,6Z,8Z)-N,2-di(propan-2-yl)-3,4-dihydrocycloocta[c]pyridin-1-imine |
|---|---|
| PubChem CID | 174047615 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (4aZ,6Z,8Z)-N,2-di(propan-2-yl)-3,4-dihydrocycloocta[c]pyridin-1-imine |
| SMILES | CC(C)/N=C1\C2=C/C=C\C=C/C=C\2CCN1C(C)C |
| InChI | InChI=1S/C17H24N2/c1-13(2)18-17-16-10-8-6-5-7-9-15(16)11-12-19(17)14(3)4/h5-10,13-14H,11-12H2,1-4H3/b6-5-,7-5-,8-6-,9-7-,10-8?,15-9-,16-10?,18-17+ |
| InChIKey | ZMDGBDDRDIETET-WGZYUXAUSA-N |
| XLogP | 3.89 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|