About 9-propyldodec-1-ene
9-propyldodec-1-ene (PubChem CID 174048054) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 9-propyldodec-1-ene.
Molecular Properties
| Compound Name | 9-propyldodec-1-ene |
| PubChem CID | 174048054 |
| Molecular Formula | C15H30 |
| Molecular Weight | 210.40 g/mol |
| Exact Mass | 210.23 |
| IUPAC Name | 9-propyldodec-1-ene |
| SMILES | C=CCCCCCCC(CCC)CCC |
| InChI | InChI=1S/C15H30/c1-4-7-8-9-10-11-14-15(12-5-2)13-6-3/h4,15H,1,5-14H2,2-3H3 |
| InChIKey | IUGJLBSVBLOKTM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 210.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-propyldodec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-propyldodec-1-ene?
The IUPAC name of 9-propyldodec-1-ene (CID 174048054) is 9-propyldodec-1-ene.
What is the SMILES notation for 9-propyldodec-1-ene?
The canonical SMILES for 9-propyldodec-1-ene is C=CCCCCCCC(CCC)CCC.
What is the InChIKey of 9-propyldodec-1-ene?
The InChIKey is IUGJLBSVBLOKTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-4-7-8-9-10-11-14-15(12-5-2)13-6-3/h4,15H,1,5-14H2,2-3H3.
What are the key properties of 9-propyldodec-1-ene?
9-propyldodec-1-ene has a molecular weight of 210.40 g/mol, XLogP of 5.73, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-propyldodec-1-ene is sourced from PubChem (CID 174048054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).