C36H40P2 — CID 174048387
(4-diphenylphosphanyl-5-ethyl-2,7-dimethylocta-1,7-dien-4-yl)-diphenylphosphane (PubChem CID 174048387) has the molecular formula C36H40P2 and a molecular weight of 534.66 g/mol. Its IUPAC name is (4-diphenylphosphanyl-5-ethyl-2,7-dimethylocta-1,7-dien-4-yl)-diphenylphosphane.
| Compound Name | (4-diphenylphosphanyl-5-ethyl-2,7-dimethylocta-1,7-dien-4-yl)-diphenylphosphane |
|---|---|
| PubChem CID | 174048387 |
| Molecular Formula | C36H40P2 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (4-diphenylphosphanyl-5-ethyl-2,7-dimethylocta-1,7-dien-4-yl)-diphenylphosphane |
| SMILES | C=C(C)CC(CC)C(CC(=C)C)(P(c1ccccc1)c1ccccc1)P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H40P2/c1-6-31(27-29(2)3)36(28-30(4)5,37(32-19-11-7-12-20-32)33-21-13-8-14-22-33)38(34-23-15-9-16-24-34)35-25-17-10-18-26-35/h7-26,31H,2,4,6,27-28H2,1,3,5H3 |
| InChIKey | PBCHCIYDAVPNSO-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|