About pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide
pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide (PubChem CID 174049042) has the molecular formula C22H21BrNO2P
and a molecular weight of 442.29 g/mol. Its IUPAC name is pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide.
Molecular Properties
| Compound Name | pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide |
| PubChem CID | 174049042 |
| Molecular Formula | C22H21BrNO2P |
| Molecular Weight | 442.29 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide |
| SMILES | Br.O=C1CCC(=O)N1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C4H5NO2.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-3-1-2-4(7)5-3;/h1-15H;1-2H2,(H,5,6,7);1H |
| InChIKey | NQDKVJAVQIQGQV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide?
The IUPAC name of pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide (CID 174049042) is pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide.
What is the SMILES notation for pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide?
The canonical SMILES for pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide is Br.O=C1CCC(=O)N1.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide?
The InChIKey is NQDKVJAVQIQGQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C4H5NO2.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-3-1-2-4(7)5-3;/h1-15H;1-2H2,(H,5,6,7);1H.
What are the key properties of pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide?
pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide has a molecular weight of 442.29 g/mol, XLogP of 3.45, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidine-2,5-dione;triphenylphosphane;hydrobromide is sourced from PubChem (CID 174049042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).