C31H38N4O3SSi — CID 174049049
N-[[(6S)-6-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonimidoyl]-1,1,1-triphenylmethanamine (PubChem CID 174049049) has the molecular formula C31H38N4O3SSi and a molecular weight of 574.82 g/mol. Its IUPAC name is N-[[(6S)-6-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonimidoyl]-1,1,1-triphenylmethanamine.
| Compound Name | N-[[(6S)-6-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonimidoyl]-1,1,1-triphenylmethanamine |
|---|---|
| PubChem CID | 174049049 |
| Molecular Formula | C31H38N4O3SSi |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | N-[[(6S)-6-[tert-butyl(dimethyl)silyl]oxy-6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl]sulfonimidoyl]-1,1,1-triphenylmethanamine |
| SMILES | [H]N=S(=O)(NC(c1ccccc1)(c1ccccc1)c1ccccc1)c1cnn2c1OC[C@@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C31H38N4O3SSi/c1-30(2,3)40(4,5)38-27-22-35-29(37-23-27)28(21-33-35)39(32,36)34-31(24-15-9-6-10-16-24,25-17-11-7-12-18-25)26-19-13-8-14-20-26/h6-21,27H,22-23H2,1-5H3,(H2,32,34,36)/t27-,39?/m0/s1 |
| InChIKey | AGYDMJSVMXSTRT-AMMNVMIRSA-N |
| XLogP | 6.57 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|