About piperidine;piperidin-1-ylcarbamic acid
piperidine;piperidin-1-ylcarbamic acid (PubChem CID 174049201) has the molecular formula C11H23N3O2
and a molecular weight of 229.32 g/mol. Its IUPAC name is piperidine;piperidin-1-ylcarbamic acid.
Molecular Properties
| Compound Name | piperidine;piperidin-1-ylcarbamic acid |
| PubChem CID | 174049201 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | piperidine;piperidin-1-ylcarbamic acid |
| SMILES | C1CCNCC1.O=C(O)NN1CCCCC1 |
| InChI | InChI=1S/C6H12N2O2.C5H11N/c9-6(10)7-8-4-2-1-3-5-8;1-2-4-6-5-3-1/h7H,1-5H2,(H,9,10);6H,1-5H2 |
| InChIKey | YLTMDZPHHLQWRW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine;piperidin-1-ylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine;piperidin-1-ylcarbamic acid?
The IUPAC name of piperidine;piperidin-1-ylcarbamic acid (CID 174049201) is piperidine;piperidin-1-ylcarbamic acid.
What is the SMILES notation for piperidine;piperidin-1-ylcarbamic acid?
The canonical SMILES for piperidine;piperidin-1-ylcarbamic acid is C1CCNCC1.O=C(O)NN1CCCCC1.
What is the InChIKey of piperidine;piperidin-1-ylcarbamic acid?
The InChIKey is YLTMDZPHHLQWRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C5H11N/c9-6(10)7-8-4-2-1-3-5-8;1-2-4-6-5-3-1/h7H,1-5H2,(H,9,10);6H,1-5H2.
What are the key properties of piperidine;piperidin-1-ylcarbamic acid?
piperidine;piperidin-1-ylcarbamic acid has a molecular weight of 229.32 g/mol, XLogP of 1.41, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine;piperidin-1-ylcarbamic acid is sourced from PubChem (CID 174049201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).