About 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine
6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine (PubChem CID 174049947) has the molecular formula C9H9BrN4S
and a molecular weight of 285.17 g/mol. Its IUPAC name is 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine |
| PubChem CID | 174049947 |
| Molecular Formula | C9H9BrN4S |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine |
| SMILES | CNc1nc2nc(SC)ncc2cc1Br |
| InChI | InChI=1S/C9H9BrN4S/c1-11-8-6(10)3-5-4-12-9(15-2)14-7(5)13-8/h3-4H,1-2H3,(H,11,12,13,14) |
| InChIKey | PKOSZGKWCWZHJF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine?
The IUPAC name of 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine (CID 174049947) is 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine.
What is the SMILES notation for 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine?
The canonical SMILES for 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine is CNc1nc2nc(SC)ncc2cc1Br.
What is the InChIKey of 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine?
The InChIKey is PKOSZGKWCWZHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN4S/c1-11-8-6(10)3-5-4-12-9(15-2)14-7(5)13-8/h3-4H,1-2H3,(H,11,12,13,14).
What are the key properties of 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine?
6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine has a molecular weight of 285.17 g/mol, XLogP of 2.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-amine is sourced from PubChem (CID 174049947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).