About sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride
sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride (PubChem CID 174050027) has the molecular formula C17H19N2Na
and a molecular weight of 274.34 g/mol. Its IUPAC name is sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride.
Molecular Properties
| Compound Name | sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride |
| PubChem CID | 174050027 |
| Molecular Formula | C17H19N2Na |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride |
| SMILES | CCC(C)Nc1cc2ccccc2c2cnccc12.[H-].[Na+] |
| InChI | InChI=1S/C17H18N2.Na.H/c1-3-12(2)19-17-10-13-6-4-5-7-14(13)16-11-18-9-8-15(16)17;;/h4-12,19H,3H2,1-2H3;;/q;+1;-1 |
| InChIKey | LXCBRMXTDTURET-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride?
The IUPAC name of sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride (CID 174050027) is sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride.
What is the SMILES notation for sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride?
The canonical SMILES for sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride is CCC(C)Nc1cc2ccccc2c2cnccc12.[H-].[Na+].
What is the InChIKey of sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride?
The InChIKey is LXCBRMXTDTURET-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2.Na.H/c1-3-12(2)19-17-10-13-6-4-5-7-14(13)16-11-18-9-8-15(16)17;;/h4-12,19H,3H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride?
sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride has a molecular weight of 274.34 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;N-butan-2-ylbenzo[h]isoquinolin-5-amine;hydride is sourced from PubChem (CID 174050027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).