C14H17N5 — CID 174050834
N'-(4-pyrrolidin-1-ylquinazolin-2-yl)ethene-1,2-diamine (PubChem CID 174050834) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is N'-(4-pyrrolidin-1-ylquinazolin-2-yl)ethene-1,2-diamine.
| Compound Name | N'-(4-pyrrolidin-1-ylquinazolin-2-yl)ethene-1,2-diamine |
|---|---|
| PubChem CID | 174050834 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N'-(4-pyrrolidin-1-ylquinazolin-2-yl)ethene-1,2-diamine |
| SMILES | NC=CNc1nc(N2CCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C14H17N5/c15-7-8-16-14-17-12-6-2-1-5-11(12)13(18-14)19-9-3-4-10-19/h1-2,5-8H,3-4,9-10,15H2,(H,16,17,18) |
| InChIKey | DPKZGIANDYCNTJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |