About 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole
3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole (PubChem CID 174050882) has the molecular formula C5H6N4O
and a molecular weight of 138.13 g/mol. Its IUPAC name is 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole |
| PubChem CID | 174050882 |
| Molecular Formula | C5H6N4O |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole |
| SMILES | c1cnn(C2=NOCC2)n1 |
| InChI | InChI=1S/C5H6N4O/c1-4-10-8-5(1)9-6-2-3-7-9/h2-3H,1,4H2 |
| InChIKey | LCYLESQEZXRHJF-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole?
The IUPAC name of 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole (CID 174050882) is 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole is c1cnn(C2=NOCC2)n1.
What is the InChIKey of 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole?
The InChIKey is LCYLESQEZXRHJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O/c1-4-10-8-5(1)9-6-2-3-7-9/h2-3H,1,4H2.
What are the key properties of 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole?
3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole has a molecular weight of 138.13 g/mol, XLogP of -0.14, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(triazol-2-yl)-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 174050882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).