C18H22N6OS — CID 17405103
2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2-benzylsulfanylethyl)acetamide (PubChem CID 17405103) has the molecular formula C18H22N6OS and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2-benzylsulfanylethyl)acetamide.
| Compound Name | 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2-benzylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 17405103 |
| Molecular Formula | C18H22N6OS |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-N-(2-benzylsulfanylethyl)acetamide |
| SMILES | Cc1nc2nc(N)nn2c(C)c1CC(=O)NCCSCc1ccccc1 |
| InChI | InChI=1S/C18H22N6OS/c1-12-15(13(2)24-18(21-12)22-17(19)23-24)10-16(25)20-8-9-26-11-14-6-4-3-5-7-14/h3-7H,8-11H2,1-2H3,(H2,19,23)(H,20,25) |
| InChIKey | CYAHDJYMEJTMHW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 98.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|