C16H30O5Si — CID 174052934
2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-methylideneoxan-2-yl]propanoic acid (PubChem CID 174052934) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is 2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-methylideneoxan-2-yl]propanoic acid.
| Compound Name | 2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-methylideneoxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 174052934 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[(2S,5S,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-(hydroxymethyl)-4-methylideneoxan-2-yl]propanoic acid |
| SMILES | C=C1C[C@@H](C(C)C(=O)O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O5Si/c1-10-8-12(11(2)15(18)19)20-13(9-17)14(10)21-22(6,7)16(3,4)5/h11-14,17H,1,8-9H2,2-7H3,(H,18,19)/t11?,12-,13+,14-/m0/s1 |
| InChIKey | WCXDIWRMIGIOBD-GSPSYOTPSA-N |
| XLogP | 2.80 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|