C16H22FN3O3 — CID 174053887
(3S)-4-(2,2-dimethylpropanoyl)-6-fluoro-N'-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboximidamide (PubChem CID 174053887) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is (3S)-4-(2,2-dimethylpropanoyl)-6-fluoro-N'-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboximidamide.
| Compound Name | (3S)-4-(2,2-dimethylpropanoyl)-6-fluoro-N'-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboximidamide |
|---|---|
| PubChem CID | 174053887 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (3S)-4-(2,2-dimethylpropanoyl)-6-fluoro-N'-hydroxy-3-methyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboximidamide |
| SMILES | C[C@H]1COc2cc(C(N)=NO)cc(F)c2CN1C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H22FN3O3/c1-9-8-23-13-6-10(14(18)19-22)5-12(17)11(13)7-20(9)15(21)16(2,3)4/h5-6,9,22H,7-8H2,1-4H3,(H2,18,19)/t9-/m0/s1 |
| InChIKey | PXFIKBVVPKEQOR-VIFPVBQESA-N |
| XLogP | 2.08 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|