C17H15N5O3 — CID 17405466
1,3-dimethyl-7-[(2-phenyl-1,3-oxazol-4-yl)methyl]purine-2,6-dione (PubChem CID 17405466) has the molecular formula C17H15N5O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 1,3-dimethyl-7-[(2-phenyl-1,3-oxazol-4-yl)methyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[(2-phenyl-1,3-oxazol-4-yl)methyl]purine-2,6-dione |
|---|---|
| PubChem CID | 17405466 |
| Molecular Formula | C17H15N5O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1,3-dimethyl-7-[(2-phenyl-1,3-oxazol-4-yl)methyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2Cc2coc(-c3ccccc3)n2)n(C)c1=O |
| InChI | InChI=1S/C17H15N5O3/c1-20-14-13(16(23)21(2)17(20)24)22(10-18-14)8-12-9-25-15(19-12)11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3 |
| InChIKey | MSJLPPWNFVJLTA-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |