C31H40BN5O4 — CID 174054678
tert-butyl (3S)-6-(1H-indazol-5-yl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 174054678) has the molecular formula C31H40BN5O4 and a molecular weight of 557.50 g/mol. Its IUPAC name is tert-butyl (3S)-6-(1H-indazol-5-yl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | tert-butyl (3S)-6-(1H-indazol-5-yl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 174054678 |
| Molecular Formula | C31H40BN5O4 |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | tert-butyl (3S)-6-(1H-indazol-5-yl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate;5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | CC1(C)OB(c2ccc3[nH]ncc3c2)OC1(C)C.C[C@H]1CC=C(c2ccc3[nH]ncc3c2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H23N3O2.C13H17BN2O2/c1-12-5-8-16(21(11-12)17(22)23-18(2,3)4)13-6-7-15-14(9-13)10-19-20-15;1-12(2)13(3,4)18-14(17-12)10-5-6-11-9(7-10)8-15-16-11/h6-10,12H,5,11H2,1-4H3,(H,19,20);5-8H,1-4H3,(H,15,16)/t12-;/m0./s1 |
| InChIKey | XMYWEMPLGYFDGR-YDALLXLXSA-N |
| XLogP | 6.04 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|