C22H32BBrN2O5 — CID 174054878
5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylic acid (PubChem CID 174054878) has the molecular formula C22H32BBrN2O5 and a molecular weight of 495.22 g/mol. Its IUPAC name is 5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylic acid.
| Compound Name | 5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 174054878 |
| Molecular Formula | C22H32BBrN2O5 |
| Molecular Weight | 495.22 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 5-[[4-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2-tert-butyl-3-methyl-4-oxoimidazolidine-1-carboxylic acid |
| SMILES | CN1C(=O)C(Cc2ccc(Br)cc2B2OC(C)(C)C(C)(C)O2)N(C(=O)O)C1C(C)(C)C |
| InChI | InChI=1S/C22H32BBrN2O5/c1-20(2,3)18-25(8)17(27)16(26(18)19(28)29)11-13-9-10-14(24)12-15(13)23-30-21(4,5)22(6,7)31-23/h9-10,12,16,18H,11H2,1-8H3,(H,28,29) |
| InChIKey | IBCTTYPCVIMNNV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.22 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|