C29H27FN6O3S — CID 174055481
3-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(5-methyl-1H-pyrazol-4-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal (PubChem CID 174055481) has the molecular formula C29H27FN6O3S and a molecular weight of 558.64 g/mol. Its IUPAC name is 3-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(5-methyl-1H-pyrazol-4-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal.
| Compound Name | 3-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(5-methyl-1H-pyrazol-4-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal |
|---|---|
| PubChem CID | 174055481 |
| Molecular Formula | C29H27FN6O3S |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 3-[2-[7-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(5-methyl-1H-pyrazol-4-yl)thieno[3,2-c]pyridin-6-yl]-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal |
| SMILES | COCCOc1cc(F)ccc1-c1c(-c2cc3n(n2)CCN(C=CC=O)C3)nc(-c2cn[nH]c2C)c2ccsc12 |
| InChI | InChI=1S/C29H27FN6O3S/c1-18-23(16-31-33-18)27-22-6-13-40-29(22)26(21-5-4-19(30)14-25(21)39-12-11-38-2)28(32-27)24-15-20-17-35(7-3-10-37)8-9-36(20)34-24/h3-7,10,13-16H,8-9,11-12,17H2,1-2H3,(H,31,33) |
| InChIKey | IEIRUNLXXBAMBU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|