C34H30F2N6O3S — CID 174055632
3-[(6R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal (PubChem CID 174055632) has the molecular formula C34H30F2N6O3S and a molecular weight of 640.72 g/mol. Its IUPAC name is 3-[(6R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal.
| Compound Name | 3-[(6R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal |
|---|---|
| PubChem CID | 174055632 |
| Molecular Formula | C34H30F2N6O3S |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.21 |
| IUPAC Name | 3-[(6R)-2-[7-[2,4-difluoro-6-(2-methoxyethoxy)phenyl]-4-(2-methylindazol-5-yl)thieno[3,2-c]pyridin-6-yl]-6-methyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-5-yl]prop-2-enal |
| SMILES | COCCOc1cc(F)cc(F)c1-c1c(-c2cc3n(n2)C[C@@H](C)N(C=CC=O)C3)nc(-c2ccc3nn(C)cc3c2)c2ccsc12 |
| InChI | InChI=1S/C34H30F2N6O3S/c1-20-17-42-24(19-41(20)8-4-9-43)16-28(39-42)33-31(30-26(36)14-23(35)15-29(30)45-11-10-44-3)34-25(7-12-46-34)32(37-33)21-5-6-27-22(13-21)18-40(2)38-27/h4-9,12-16,18,20H,10-11,17,19H2,1-3H3/t20-/m1/s1 |
| InChIKey | QHGTYYQTDBLRAM-HXUWFJFHSA-N |
| XLogP | 6.60 |
| TPSA | 87.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|