C11H21FO4Si — CID 174055708
(2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolane-2-carboxylic acid (PubChem CID 174055708) has the molecular formula C11H21FO4Si and a molecular weight of 264.37 g/mol. Its IUPAC name is (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolane-2-carboxylic acid.
| Compound Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 174055708 |
| Molecular Formula | C11H21FO4Si |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-fluorooxolane-2-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@@H](C(=O)O)[C@H]1F |
| InChI | InChI=1S/C11H21FO4Si/c1-11(2,3)17(4,5)16-7-6-15-9(8(7)12)10(13)14/h7-9H,6H2,1-5H3,(H,13,14)/t7-,8+,9-/m1/s1 |
| InChIKey | DCRZIKYOHQJODC-HRDYMLBCSA-N |
| XLogP | 2.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|