C42H76N4O3 — CID 174055981
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-[3-aminopropyl-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoate (PubChem CID 174055981) has the molecular formula C42H76N4O3 and a molecular weight of 685.09 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-[3-aminopropyl-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-[3-aminopropyl-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 174055981 |
| Molecular Formula | C42H76N4O3 |
| Molecular Weight | 685.09 g/mol |
| Exact Mass | 684.59 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 5-[3-aminopropyl-[4-(3-aminopropylamino)butyl]amino]-5-oxopentanoate |
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)CCCC(=O)N(CCCN)CCCCNCCCN)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C42H76N4O3/c1-31(2)12-8-13-32(3)36-18-19-37-35-17-16-33-30-34(20-22-41(33,4)38(35)21-23-42(36,37)5)49-40(48)15-9-14-39(47)46(29-11-25-44)28-7-6-26-45-27-10-24-43/h16,31-32,34-38,45H,6-15,17-30,43-44H2,1-5H3 |
| InChIKey | QWPQAUHSLMNQLP-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.09 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|