About boric acid;2-(iodomethyl)-1H-indole
boric acid;2-(iodomethyl)-1H-indole (PubChem CID 174056153) has the molecular formula C9H11BINO3
and a molecular weight of 318.91 g/mol. Its IUPAC name is boric acid;2-(iodomethyl)-1H-indole.
Molecular Properties
| Compound Name | boric acid;2-(iodomethyl)-1H-indole |
| PubChem CID | 174056153 |
| Molecular Formula | C9H11BINO3 |
| Molecular Weight | 318.91 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | boric acid;2-(iodomethyl)-1H-indole |
| SMILES | ICc1cc2ccccc2[nH]1.OB(O)O |
| InChI | InChI=1S/C9H8IN.BH3O3/c10-6-8-5-7-3-1-2-4-9(7)11-8;2-1(3)4/h1-5,11H,6H2;2-4H |
| InChIKey | JECAYIUIJFYROR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.91 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze boric acid;2-(iodomethyl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;2-(iodomethyl)-1H-indole?
The IUPAC name of boric acid;2-(iodomethyl)-1H-indole (CID 174056153) is boric acid;2-(iodomethyl)-1H-indole.
What is the SMILES notation for boric acid;2-(iodomethyl)-1H-indole?
The canonical SMILES for boric acid;2-(iodomethyl)-1H-indole is ICc1cc2ccccc2[nH]1.OB(O)O.
What is the InChIKey of boric acid;2-(iodomethyl)-1H-indole?
The InChIKey is JECAYIUIJFYROR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8IN.BH3O3/c10-6-8-5-7-3-1-2-4-9(7)11-8;2-1(3)4/h1-5,11H,6H2;2-4H.
What are the key properties of boric acid;2-(iodomethyl)-1H-indole?
boric acid;2-(iodomethyl)-1H-indole has a molecular weight of 318.91 g/mol, XLogP of 1.05, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;2-(iodomethyl)-1H-indole is sourced from PubChem (CID 174056153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).