C26H24F6N4O4 — CID 174056209
[(6R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamic acid (PubChem CID 174056209) has the molecular formula C26H24F6N4O4 and a molecular weight of 570.49 g/mol. Its IUPAC name is [(6R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamic acid.
| Compound Name | [(6R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamic acid |
|---|---|
| PubChem CID | 174056209 |
| Molecular Formula | C26H24F6N4O4 |
| Molecular Weight | 570.49 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | [(6R)-12-methyl-6-phenylmethoxy-6,15-bis(trifluoromethyl)-19-oxa-3,4,18-triazatricyclo[12.3.1.12,5]nonadeca-1(17),2,4,9,14(18),15-hexaen-17-yl]carbamic acid |
| SMILES | CC1CC=CCC[C@](OCc2ccccc2)(C(F)(F)F)c2nnc(o2)-c2nc(c(C(F)(F)F)cc2NC(=O)O)C1 |
| InChI | InChI=1S/C26H24F6N4O4/c1-15-8-4-3-7-11-24(26(30,31)32,39-14-16-9-5-2-6-10-16)22-36-35-21(40-22)20-19(34-23(37)38)13-17(25(27,28)29)18(12-15)33-20/h2-6,9-10,13,15,34H,7-8,11-12,14H2,1H3,(H,37,38)/t15?,24-/m1/s1 |
| InChIKey | KDAQASCPLVNLRO-VXQRJTRRSA-N |
| XLogP | 7.13 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.49 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|