C22H25N5OS — CID 174056509
tert-butyl-[1-(9-methyl-5-phenyl-[1,2,4]triazolo[4,3-c]quinazolin-7-yl)ethylamino]-oxidosulfanium (PubChem CID 174056509) has the molecular formula C22H25N5OS and a molecular weight of 407.54 g/mol. Its IUPAC name is tert-butyl-[1-(9-methyl-5-phenyl-[1,2,4]triazolo[4,3-c]quinazolin-7-yl)ethylamino]-oxidosulfanium.
| Compound Name | tert-butyl-[1-(9-methyl-5-phenyl-[1,2,4]triazolo[4,3-c]quinazolin-7-yl)ethylamino]-oxidosulfanium |
|---|---|
| PubChem CID | 174056509 |
| Molecular Formula | C22H25N5OS |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | tert-butyl-[1-(9-methyl-5-phenyl-[1,2,4]triazolo[4,3-c]quinazolin-7-yl)ethylamino]-oxidosulfanium |
| SMILES | Cc1cc(C(C)N[S+]([O-])C(C)(C)C)c2nc(-c3ccccc3)n3cnnc3c2c1 |
| InChI | InChI=1S/C22H25N5OS/c1-14-11-17(15(2)26-29(28)22(3,4)5)19-18(12-14)21-25-23-13-27(21)20(24-19)16-9-7-6-8-10-16/h6-13,15,26H,1-5H3 |
| InChIKey | MMTTWMXQDWVRTC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|