C27H42N6O7SSi — CID 174057517
N-[9-[(2R,3R,5S)-5-(aminomethyl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide;4-methylbenzenesulfonic acid (PubChem CID 174057517) has the molecular formula C27H42N6O7SSi and a molecular weight of 622.82 g/mol. Its IUPAC name is N-[9-[(2R,3R,5S)-5-(aminomethyl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide;4-methylbenzenesulfonic acid.
| Compound Name | N-[9-[(2R,3R,5S)-5-(aminomethyl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 174057517 |
| Molecular Formula | C27H42N6O7SSi |
| Molecular Weight | 622.82 g/mol |
| Exact Mass | 622.26 |
| IUPAC Name | N-[9-[(2R,3R,5S)-5-(aminomethyl)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-methylpropanamide;4-methylbenzenesulfonic acid |
| SMILES | CC(C)C(=O)Nc1nc2c(ncn2[C@@H]2O[C@H](CN)C[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)[nH]1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H34N6O4Si.C7H8O3S/c1-11(2)16(27)24-19-23-15-14(17(28)25-19)22-10-26(15)18-13(8-12(9-21)29-18)30-31(6,7)20(3,4)5;1-6-2-4-7(5-3-6)11(8,9)10/h10-13,18H,8-9,21H2,1-7H3,(H2,23,24,25,27,28);2-5H,1H3,(H,8,9,10)/t12-,13+,18+;/m0./s1 |
| InChIKey | VLCVTXBGCFAFNX-HTZFSKRBSA-N |
| XLogP | 3.59 |
| TPSA | 191.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.82 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|