C36H39F2N5O2Si — CID 174057649
(2S)-2-(cyanomethyl)-4-[2,8-difluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]quinazolin-4-yl]piperazine-1-carboxylic acid (PubChem CID 174057649) has the molecular formula C36H39F2N5O2Si and a molecular weight of 639.82 g/mol. Its IUPAC name is (2S)-2-(cyanomethyl)-4-[2,8-difluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]quinazolin-4-yl]piperazine-1-carboxylic acid.
| Compound Name | (2S)-2-(cyanomethyl)-4-[2,8-difluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]quinazolin-4-yl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174057649 |
| Molecular Formula | C36H39F2N5O2Si |
| Molecular Weight | 639.82 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | (2S)-2-(cyanomethyl)-4-[2,8-difluoro-7-[8-[2-tri(propan-2-yl)silylethynyl]naphthalen-1-yl]quinazolin-4-yl]piperazine-1-carboxylic acid |
| SMILES | CC(C)[Si](C#Cc1cccc2cccc(-c3ccc4c(N5CCN(C(=O)O)[C@@H](CC#N)C5)nc(F)nc4c3F)c12)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H39F2N5O2Si/c1-22(2)46(23(3)4,24(5)6)20-16-26-10-7-9-25-11-8-12-28(31(25)26)29-13-14-30-33(32(29)37)40-35(38)41-34(30)42-18-19-43(36(44)45)27(21-42)15-17-39/h7-14,22-24,27H,15,18-19,21H2,1-6H3,(H,44,45)/t27-/m0/s1 |
| InChIKey | MHDYHXRPTRVZOZ-MHZLTWQESA-N |
| XLogP | 8.38 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.82 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|