C19H21N3O3S — CID 17405777
N-[cyclopropyl-(4-methylphenyl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 17405777) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methylphenyl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-[cyclopropyl-(4-methylphenyl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 17405777 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-[cyclopropyl-(4-methylphenyl)methyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)C2=CC=CN3CCS(=O)(=O)N=C23)C2CC2)cc1 |
| InChI | InChI=1S/C19H21N3O3S/c1-13-4-6-14(7-5-13)17(15-8-9-15)20-19(23)16-3-2-10-22-11-12-26(24,25)21-18(16)22/h2-7,10,15,17H,8-9,11-12H2,1H3,(H,20,23) |
| InChIKey | QZBUNESWGVHOPT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |