C31H39ClN2Pd — CID 174057888
chloropalladium(1+);2-[2,6-di(propan-2-yl)phenyl]-5-(2,4,6-triethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide (PubChem CID 174057888) has the molecular formula C31H39ClN2Pd and a molecular weight of 581.54 g/mol. Its IUPAC name is chloropalladium(1+);2-[2,6-di(propan-2-yl)phenyl]-5-(2,4,6-triethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide.
| Compound Name | chloropalladium(1+);2-[2,6-di(propan-2-yl)phenyl]-5-(2,4,6-triethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide |
|---|---|
| PubChem CID | 174057888 |
| Molecular Formula | C31H39ClN2Pd |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.18 |
| IUPAC Name | chloropalladium(1+);2-[2,6-di(propan-2-yl)phenyl]-5-(2,4,6-triethylphenyl)-3H-imidazo[1,5-a]pyridin-3-ide |
| SMILES | CCc1cc(CC)c(C2=CC=CC3=CN(c4c(C(C)C)cccc4C(C)C)[CH-]N32)c(CC)c1.Cl[Pd+] |
| InChI | InChI=1S/C31H39N2.ClH.Pd/c1-8-23-17-24(9-2)30(25(10-3)18-23)29-16-11-13-26-19-32(20-33(26)29)31-27(21(4)5)14-12-15-28(31)22(6)7;;/h11-22H,8-10H2,1-7H3;1H;/q-1;;+2/p-1 |
| InChIKey | YZQUZBCDAAEPTA-UHFFFAOYSA-M |
| XLogP | 9.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|