C23H18F2N2O4 — CID 17405811
5-(2,5-difluorophenyl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 17405811) has the molecular formula C23H18F2N2O4 and a molecular weight of 424.40 g/mol. Its IUPAC name is 5-(2,5-difluorophenyl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2,5-difluorophenyl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17405811 |
| Molecular Formula | C23H18F2N2O4 |
| Molecular Weight | 424.40 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 5-(2,5-difluorophenyl)-5-methyl-3-[(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2cc(F)ccc2F)NC(=O)N(Cc2cc(=O)oc3cc4c(cc23)CCC4)C1=O |
| InChI | InChI=1S/C23H18F2N2O4/c1-23(17-10-15(24)5-6-18(17)25)21(29)27(22(30)26-23)11-14-9-20(28)31-19-8-13-4-2-3-12(13)7-16(14)19/h5-10H,2-4,11H2,1H3,(H,26,30) |
| InChIKey | FGNWCNXPEHXQOG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|